Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, SDS of cas: 17318-31-9, 17318-31-9, Name is SQ22536, SMILES is NC1=C2N=CN(C3OCCC3)C2=NC=N1, belongs to indole-building-block compound. In a document, author is Jagadeesh, Chenna, introduce the new discover.
Unprecedented Reactivity of gamma-Amino Cyclopentenone Enables Diversity-Oriented Access to Functionalized Indoles and Indole-Annulated Ring Structures
Observation of an unexpected, Lewis acid promoted displacement of latent reactive gamma-amino group on cyclopentenone presented unparalleled opportunity for enone functionalization and annulations with indole derivatives, which is developed in the current study. Herein, a vast range of C3/N-indolyl enones and indole alkaloid-like compound were accessed in excellent yields (up to 99 %) and selectivity through a one-pot operation. The mechanism most likely involves an unprecedented trait of Piancatelli-type rearrangement where influence of the gem-diaryl group appeared crucial.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 17318-31-9. SDS of cas: 17318-31-9.
Reference:
Indole alkaloid derivatives as building blocks of natural products from?Bacillus thuringiensis?and?Bacillus velezensis?and their antibacterial and antifungal activity study,
,Preparation of Indole Containing Building Blocks for the Regiospecific Construction of Indole Appended Pyrazoles and Pyrroles