Brief introduction of AT9283

The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 896466-04-9 is helpful to your research. Computed Properties of https://www.ambeed.com/products/896466-04-9.html.

Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 896466-04-9, Name is AT9283, SMILES is O=C(NC1CC1)NC1=CNN=C1C1=NC2=C(N1)C=CC(CN1CCOCC1)=C2, belongs to indole-building-block compound. In a document, author is Zhou, Xiao-Yu, introduce the new discover, Computed Properties of https://www.ambeed.com/products/896466-04-9.html.

Herein, we described a ruthenium catalyzed oxidation and C-C bond formation reaction of 2-alkyl or 2-aryl substituted indoles using tert-butyl hydroperoxide (TBHP) as oxidant. Coupled with cascade transformation, it provided a mild catalytic oxidation system for the synthesis of 2-indolylindolin-3-ones. The reaction could readily occur using RuCl3 center dot 3H(2)O as catalyst, and the target product was obtained with medium to high yield.

The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 896466-04-9 is helpful to your research. Computed Properties of https://www.ambeed.com/products/896466-04-9.html.

Reference:
Indole alkaloid derivatives as building blocks of natural products from Bacillus thuringiensis and Bacillus velezensis and their antibacterial and antifungal activity study,
,Preparation of Indole Containing Building Blocks for the Regiospecific Construction of Indole Appended Pyrazoles and Pyrroles