Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 24280-93-1, Name is Mycophenolic acid, SMILES is O=C(O)CC/C(C)=C/CC1=C(OC)C(C)=C2COC(C2=C1O)=O, belongs to indole-building-block compound. In a document, author is Wang, Ya-Lan, introduce the new discover, Safety of Mycophenolic acid.
Bousigonine A and B, bis- and tri-indole alkaloids from Bousigonia mekongensis and their preventing high glucose-induced podocyte injury activity
Bousigonine A (1), an unprecedented eburnamine-voaphylline type dimeric indole alkaloid, and Bousigonine B (2), the first example of eburnamine-eburnamine-aspidospermine type trimeric indole alkaloid were isolated from Bousigonia mekongensis. Their structures were elucidated mainly by spectroscopic analysis and compared to published data. Their preventing high glucose-induced podocyte injury activity were evaluated for the first time, and compound I exhibited significant effect with EC50 value of 2.5 mu M. (C) 2019 Published by Elsevier Ltd.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 24280-93-1 is helpful to your research. Safety of Mycophenolic acid.
Reference:
Indole alkaloid derivatives as building blocks of natural products from?Bacillus thuringiensis?and?Bacillus velezensis?and their antibacterial and antifungal activity study,
,Preparation of Indole Containing Building Blocks for the Regiospecific Construction of Indole Appended Pyrazoles and Pyrroles