Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 76-61-9, Name is Thymol Blue, SMILES is CC1=CC(O)=C(C(C)C)C=C1C2(C3=CC(C(C)C)=C(O)C=C3C)C4=CC=CC=C4S(O2)(=O)=O, belongs to indole-building-block compound. In a document, author is Dinne, Naresh Kumar Reddy, introduce the new discover, Product Details of 76-61-9.
Wang resin-supported sulfonic acid-catalyzed multicomponent reaction in water leading to 4-oxo-4,5,6,7-tetrahydroindole derivatives
A greener approach for the synthesis of 4-oxo-4,5,6,7-tetrahydro indole derivatives has been achieved through Wang-OSO3H-mediated three-component reaction involving dimedone, phenacyl bromide, and primary amine in water. A variety of indole derivatives were prepared using this operationally simple and straight forward methodology in acceptable yields. [GRAPHICS] .
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 76-61-9 is helpful to your research. Product Details of 76-61-9.
Reference:
Indole alkaloid derivatives as building blocks of natural products from Bacillus thuringiensis and Bacillus velezensis and their antibacterial and antifungal activity study,
,Preparation of Indole Containing Building Blocks for the Regiospecific Construction of Indole Appended Pyrazoles and Pyrroles